C22H32OS2Si — CID 25016402
4,4-bis(phenylsulfanyl)butoxy-tert-butyl-dimethylsilane (PubChem CID 25016402) has the molecular formula C22H32OS2Si and a molecular weight of 404.72 g/mol. Its IUPAC name is 4,4-bis(phenylsulfanyl)butoxy-tert-butyl-dimethylsilane.
| Compound Name | 4,4-bis(phenylsulfanyl)butoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 25016402 |
| Molecular Formula | C22H32OS2Si |
| Molecular Weight | 404.72 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 4,4-bis(phenylsulfanyl)butoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C22H32OS2Si/c1-22(2,3)26(4,5)23-18-12-17-21(24-19-13-8-6-9-14-19)25-20-15-10-7-11-16-20/h6-11,13-16,21H,12,17-18H2,1-5H3 |
| InChIKey | IBASQPLJCAPVOO-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.72 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|