C27H44O2S2Si2 — CID 134878963
trimethyl-[(1S,3R)-6-phenylsulfanyl-1-(3-phenylsulfanylpropyl)-3-trimethylsilyloxyhexoxy]silane (PubChem CID 134878963) has the molecular formula C27H44O2S2Si2 and a molecular weight of 520.95 g/mol. Its IUPAC name is trimethyl-[(1S,3R)-6-phenylsulfanyl-1-(3-phenylsulfanylpropyl)-3-trimethylsilyloxyhexoxy]silane.
| Compound Name | trimethyl-[(1S,3R)-6-phenylsulfanyl-1-(3-phenylsulfanylpropyl)-3-trimethylsilyloxyhexoxy]silane |
|---|---|
| PubChem CID | 134878963 |
| Molecular Formula | C27H44O2S2Si2 |
| Molecular Weight | 520.95 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | trimethyl-[(1S,3R)-6-phenylsulfanyl-1-(3-phenylsulfanylpropyl)-3-trimethylsilyloxyhexoxy]silane |
| SMILES | C[Si](C)(C)O[C@H](CCCSc1ccccc1)C[C@H](CCCSc1ccccc1)O[Si](C)(C)C |
| InChI | InChI=1S/C27H44O2S2Si2/c1-32(2,3)28-24(15-13-21-30-26-17-9-7-10-18-26)23-25(29-33(4,5)6)16-14-22-31-27-19-11-8-12-20-27/h7-12,17-20,24-25H,13-16,21-23H2,1-6H3/t24-,25+ |
| InChIKey | BWZZKUSHNJTYHO-PLQXJYEYSA-N |
| XLogP | 8.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.95 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|