C30H58O4SSi3 — CID 164668714
[(2S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyl-2-phenylsulfanyloxan-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 164668714) has the molecular formula C30H58O4SSi3 and a molecular weight of 599.12 g/mol. Its IUPAC name is [(2S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyl-2-phenylsulfanyloxan-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyl-2-phenylsulfanyloxan-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 164668714 |
| Molecular Formula | C30H58O4SSi3 |
| Molecular Weight | 599.12 g/mol |
| Exact Mass | 598.34 |
| IUPAC Name | [(2S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyl-2-phenylsulfanyloxan-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC1O[C@@H](Sc2ccccc2)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H58O4SSi3/c1-22-24(32-36(11,12)28(2,3)4)25(33-37(13,14)29(5,6)7)26(34-38(15,16)30(8,9)10)27(31-22)35-23-20-18-17-19-21-23/h17-22,24-27H,1-16H3/t22?,24-,25?,26?,27-/m0/s1 |
| InChIKey | LRXSSXGIKHZCEO-GRLYVIMCSA-N |
| XLogP | 9.69 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.12 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|