C24H39FO4S — CID 121339762
(3S,5S,6S)-4,5-dibutoxy-2-(butoxymethyl)-3-fluoro-6-phenylsulfanyloxane (PubChem CID 121339762) has the molecular formula C24H39FO4S and a molecular weight of 442.64 g/mol. Its IUPAC name is (3S,5S,6S)-4,5-dibutoxy-2-(butoxymethyl)-3-fluoro-6-phenylsulfanyloxane.
| Compound Name | (3S,5S,6S)-4,5-dibutoxy-2-(butoxymethyl)-3-fluoro-6-phenylsulfanyloxane |
|---|---|
| PubChem CID | 121339762 |
| Molecular Formula | C24H39FO4S |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | (3S,5S,6S)-4,5-dibutoxy-2-(butoxymethyl)-3-fluoro-6-phenylsulfanyloxane |
| SMILES | CCCCOCC1O[C@@H](Sc2ccccc2)[C@@H](OCCCC)C(OCCCC)[C@H]1F |
| InChI | InChI=1S/C24H39FO4S/c1-4-7-15-26-18-20-21(25)22(27-16-8-5-2)23(28-17-9-6-3)24(29-20)30-19-13-11-10-12-14-19/h10-14,20-24H,4-9,15-18H2,1-3H3/t20?,21-,22?,23-,24-/m0/s1 |
| InChIKey | RPLQHFDHQUOLIR-GOSPLGBTSA-N |
| XLogP | 6.03 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|