C22H37F7O5SSi2 — CID 177125332
2-[[4-[dimethyl-[3-[2,3,3,3-tetrafluoro-2-(trifluoromethoxy)propoxy]propyl]silyl]phenyl]-dimethyl-λ4-sulfanyl]ethyl-trimethoxysilane (PubChem CID 177125332) has the molecular formula C22H37F7O5SSi2 and a molecular weight of 602.76 g/mol. Its IUPAC name is 2-[[4-[dimethyl-[3-[2,3,3,3-tetrafluoro-2-(trifluoromethoxy)propoxy]propyl]silyl]phenyl]-dimethyl-λ4-sulfanyl]ethyl-trimethoxysilane.
| Compound Name | 2-[[4-[dimethyl-[3-[2,3,3,3-tetrafluoro-2-(trifluoromethoxy)propoxy]propyl]silyl]phenyl]-dimethyl-λ4-sulfanyl]ethyl-trimethoxysilane |
|---|---|
| PubChem CID | 177125332 |
| Molecular Formula | C22H37F7O5SSi2 |
| Molecular Weight | 602.76 g/mol |
| Exact Mass | 602.18 |
| IUPAC Name | 2-[[4-[dimethyl-[3-[2,3,3,3-tetrafluoro-2-(trifluoromethoxy)propoxy]propyl]silyl]phenyl]-dimethyl-λ4-sulfanyl]ethyl-trimethoxysilane |
| SMILES | CO[Si](CCS(C)(C)c1ccc([Si](C)(C)CCCOCC(F)(OC(F)(F)F)C(F)(F)F)cc1)(OC)OC |
| InChI | InChI=1S/C22H37F7O5SSi2/c1-30-37(31-2,32-3)16-14-35(4,5)18-9-11-19(12-10-18)36(6,7)15-8-13-33-17-20(23,21(24,25)26)34-22(27,28)29/h9-12H,8,13-17H2,1-7H3 |
| InChIKey | UECNDYQOTMFOIU-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.76 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|