C14H19F3OSSi — CID 10829543
[(E)-2-ethoxy-3,3,3-trifluoro-1-phenylsulfanylprop-1-enyl]-trimethylsilane (PubChem CID 10829543) has the molecular formula C14H19F3OSSi and a molecular weight of 320.45 g/mol. Its IUPAC name is [(E)-2-ethoxy-3,3,3-trifluoro-1-phenylsulfanylprop-1-enyl]-trimethylsilane.
| Compound Name | [(E)-2-ethoxy-3,3,3-trifluoro-1-phenylsulfanylprop-1-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 10829543 |
| Molecular Formula | C14H19F3OSSi |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | [(E)-2-ethoxy-3,3,3-trifluoro-1-phenylsulfanylprop-1-enyl]-trimethylsilane |
| SMILES | CCO/C(=C(/Sc1ccccc1)[Si](C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C14H19F3OSSi/c1-5-18-12(14(15,16)17)13(20(2,3)4)19-11-9-7-6-8-10-11/h6-10H,5H2,1-4H3/b13-12- |
| InChIKey | MECHEFDKIQNJRL-SEYXRHQNSA-N |
| XLogP | 5.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|