C12H13F3OS2 — CID 10589891
[(E)-2-ethoxy-3,3,3-trifluoro-1-methylsulfanylprop-1-enyl]sulfanylbenzene (PubChem CID 10589891) has the molecular formula C12H13F3OS2 and a molecular weight of 294.36 g/mol. Its IUPAC name is [(E)-2-ethoxy-3,3,3-trifluoro-1-methylsulfanylprop-1-enyl]sulfanylbenzene.
| Compound Name | [(E)-2-ethoxy-3,3,3-trifluoro-1-methylsulfanylprop-1-enyl]sulfanylbenzene |
|---|---|
| PubChem CID | 10589891 |
| Molecular Formula | C12H13F3OS2 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | [(E)-2-ethoxy-3,3,3-trifluoro-1-methylsulfanylprop-1-enyl]sulfanylbenzene |
| SMILES | CCO/C(=C(\SC)Sc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H13F3OS2/c1-3-16-10(12(13,14)15)11(17-2)18-9-7-5-4-6-8-9/h4-8H,3H2,1-2H3/b11-10+ |
| InChIKey | DCUVSVMXWSCFLT-ZHACJKMWSA-N |
| XLogP | 4.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|