C14H13F3O2S — CID 10709466
(E)-5-ethoxy-6,6,6-trifluoro-4-phenylsulfanylhex-4-en-2-yn-1-ol (PubChem CID 10709466) has the molecular formula C14H13F3O2S and a molecular weight of 302.32 g/mol. Its IUPAC name is (E)-5-ethoxy-6,6,6-trifluoro-4-phenylsulfanylhex-4-en-2-yn-1-ol.
| Compound Name | (E)-5-ethoxy-6,6,6-trifluoro-4-phenylsulfanylhex-4-en-2-yn-1-ol |
|---|---|
| PubChem CID | 10709466 |
| Molecular Formula | C14H13F3O2S |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | (E)-5-ethoxy-6,6,6-trifluoro-4-phenylsulfanylhex-4-en-2-yn-1-ol |
| SMILES | CCO/C(=C(\C#CCO)Sc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C14H13F3O2S/c1-2-19-13(14(15,16)17)12(9-6-10-18)20-11-7-4-3-5-8-11/h3-5,7-8,18H,2,10H2,1H3/b13-12+ |
| InChIKey | HZGJEFGHHNXHOO-OUKQBFOZSA-N |
| XLogP | 3.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|