C18H21F3O2S — CID 10808324
(E)-2-ethoxy-1,1,1-trifluoro-7,7-dimethyl-3-phenylsulfanyloct-2-en-5-yn-4-ol (PubChem CID 10808324) has the molecular formula C18H21F3O2S and a molecular weight of 358.43 g/mol. Its IUPAC name is (E)-2-ethoxy-1,1,1-trifluoro-7,7-dimethyl-3-phenylsulfanyloct-2-en-5-yn-4-ol.
| Compound Name | (E)-2-ethoxy-1,1,1-trifluoro-7,7-dimethyl-3-phenylsulfanyloct-2-en-5-yn-4-ol |
|---|---|
| PubChem CID | 10808324 |
| Molecular Formula | C18H21F3O2S |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | (E)-2-ethoxy-1,1,1-trifluoro-7,7-dimethyl-3-phenylsulfanyloct-2-en-5-yn-4-ol |
| SMILES | CCO/C(=C(/Sc1ccccc1)C(O)C#CC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C18H21F3O2S/c1-5-23-16(18(19,20)21)15(14(22)11-12-17(2,3)4)24-13-9-7-6-8-10-13/h6-10,14,22H,5H2,1-4H3/b16-15+ |
| InChIKey | BHJXPJBHXDAYJN-FOCLMDBBSA-N |
| XLogP | 5.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|