C17H19F3OS — CID 10782507
[(E)-2-ethoxy-1,1,1-trifluoro-6,6-dimethylhept-2-en-4-yn-3-yl]sulfanylbenzene (PubChem CID 10782507) has the molecular formula C17H19F3OS and a molecular weight of 328.40 g/mol. Its IUPAC name is [(E)-2-ethoxy-1,1,1-trifluoro-6,6-dimethylhept-2-en-4-yn-3-yl]sulfanylbenzene.
| Compound Name | [(E)-2-ethoxy-1,1,1-trifluoro-6,6-dimethylhept-2-en-4-yn-3-yl]sulfanylbenzene |
|---|---|
| PubChem CID | 10782507 |
| Molecular Formula | C17H19F3OS |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | [(E)-2-ethoxy-1,1,1-trifluoro-6,6-dimethylhept-2-en-4-yn-3-yl]sulfanylbenzene |
| SMILES | CCO/C(=C(\C#CC(C)(C)C)Sc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H19F3OS/c1-5-21-15(17(18,19)20)14(11-12-16(2,3)4)22-13-9-7-6-8-10-13/h6-10H,5H2,1-4H3/b15-14+ |
| InChIKey | HKYRXHDFHOZGLG-CCEZHUSRSA-N |
| XLogP | 5.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|