C19H15F3OS — CID 10641442
[(E)-4-ethoxy-5,5,5-trifluoro-1-phenylpent-3-en-1-yn-3-yl]sulfanylbenzene (PubChem CID 10641442) has the molecular formula C19H15F3OS and a molecular weight of 348.39 g/mol. Its IUPAC name is [(E)-4-ethoxy-5,5,5-trifluoro-1-phenylpent-3-en-1-yn-3-yl]sulfanylbenzene.
| Compound Name | [(E)-4-ethoxy-5,5,5-trifluoro-1-phenylpent-3-en-1-yn-3-yl]sulfanylbenzene |
|---|---|
| PubChem CID | 10641442 |
| Molecular Formula | C19H15F3OS |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | [(E)-4-ethoxy-5,5,5-trifluoro-1-phenylpent-3-en-1-yn-3-yl]sulfanylbenzene |
| SMILES | CCO/C(=C(\C#Cc1ccccc1)Sc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C19H15F3OS/c1-2-23-18(19(20,21)22)17(24-16-11-7-4-8-12-16)14-13-15-9-5-3-6-10-15/h3-12H,2H2,1H3/b18-17+ |
| InChIKey | CZBUSFYKAIJKHF-ISLYRVAYSA-N |
| XLogP | 5.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|