C18H17F3OS — CID 10712042
[(E)-3-ethoxy-4,4,4-trifluoro-1-phenylbut-2-en-2-yl]sulfanylbenzene (PubChem CID 10712042) has the molecular formula C18H17F3OS and a molecular weight of 338.39 g/mol. Its IUPAC name is [(E)-3-ethoxy-4,4,4-trifluoro-1-phenylbut-2-en-2-yl]sulfanylbenzene.
| Compound Name | [(E)-3-ethoxy-4,4,4-trifluoro-1-phenylbut-2-en-2-yl]sulfanylbenzene |
|---|---|
| PubChem CID | 10712042 |
| Molecular Formula | C18H17F3OS |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | [(E)-3-ethoxy-4,4,4-trifluoro-1-phenylbut-2-en-2-yl]sulfanylbenzene |
| SMILES | CCO/C(=C(\Cc1ccccc1)Sc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H17F3OS/c1-2-22-17(18(19,20)21)16(13-14-9-5-3-6-10-14)23-15-11-7-4-8-12-15/h3-12H,2,13H2,1H3/b17-16+ |
| InChIKey | JSBREXPIZBHWFZ-WUKNDPDISA-N |
| XLogP | 5.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|