C13H15F3OS — CID 10660077
[(E)-3-ethoxy-4,4,4-trifluoro-2-methylsulfanylbut-2-enyl]benzene (PubChem CID 10660077) has the molecular formula C13H15F3OS and a molecular weight of 276.32 g/mol. Its IUPAC name is [(E)-3-ethoxy-4,4,4-trifluoro-2-methylsulfanylbut-2-enyl]benzene.
| Compound Name | [(E)-3-ethoxy-4,4,4-trifluoro-2-methylsulfanylbut-2-enyl]benzene |
|---|---|
| PubChem CID | 10660077 |
| Molecular Formula | C13H15F3OS |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | [(E)-3-ethoxy-4,4,4-trifluoro-2-methylsulfanylbut-2-enyl]benzene |
| SMILES | CCO/C(=C(\Cc1ccccc1)SC)C(F)(F)F |
| InChI | InChI=1S/C13H15F3OS/c1-3-17-12(13(14,15)16)11(18-2)9-10-7-5-4-6-8-10/h4-8H,3,9H2,1-2H3/b12-11+ |
| InChIKey | QKLSPXNGQFTOKJ-VAWYXSNFSA-N |
| XLogP | 4.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|