C14H15F5O — CID 15651901
[(Z)-4-ethoxy-5,5,6,6,6-pentafluorohex-3-enyl]benzene (PubChem CID 15651901) has the molecular formula C14H15F5O and a molecular weight of 294.26 g/mol. Its IUPAC name is [(Z)-4-ethoxy-5,5,6,6,6-pentafluorohex-3-enyl]benzene.
| Compound Name | [(Z)-4-ethoxy-5,5,6,6,6-pentafluorohex-3-enyl]benzene |
|---|---|
| PubChem CID | 15651901 |
| Molecular Formula | C14H15F5O |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | [(Z)-4-ethoxy-5,5,6,6,6-pentafluorohex-3-enyl]benzene |
| SMILES | CCO/C(=C\CCc1ccccc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H15F5O/c1-2-20-12(13(15,16)14(17,18)19)10-6-9-11-7-4-3-5-8-11/h3-5,7-8,10H,2,6,9H2,1H3/b12-10- |
| InChIKey | OOKZHKACWANLOL-BENRWUELSA-N |
| XLogP | 4.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|