C19H15F15O — CID 15180602
[(Z)-4-ethoxy-5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-pentadecafluoroundec-3-enyl]benzene (PubChem CID 15180602) has the molecular formula C19H15F15O and a molecular weight of 544.30 g/mol. Its IUPAC name is [(Z)-4-ethoxy-5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-pentadecafluoroundec-3-enyl]benzene.
| Compound Name | [(Z)-4-ethoxy-5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-pentadecafluoroundec-3-enyl]benzene |
|---|---|
| PubChem CID | 15180602 |
| Molecular Formula | C19H15F15O |
| Molecular Weight | 544.30 g/mol |
| Exact Mass | 544.09 |
| IUPAC Name | [(Z)-4-ethoxy-5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-pentadecafluoroundec-3-enyl]benzene |
| SMILES | CCO/C(=C\CCc1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H15F15O/c1-2-35-12(10-6-9-11-7-4-3-5-8-11)13(20,21)14(22,23)15(24,25)16(26,27)17(28,29)18(30,31)19(32,33)34/h3-5,7-8,10H,2,6,9H2,1H3/b12-10- |
| InChIKey | SHSXHXZCMFRMPG-BENRWUELSA-N |
| XLogP | 7.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.30 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|