C16H13F3OS — CID 135036230
(Z)-1,1,1-trifluoro-4-phenyl-3-phenylsulfanylbut-2-en-2-ol (PubChem CID 135036230) has the molecular formula C16H13F3OS and a molecular weight of 310.34 g/mol. Its IUPAC name is (Z)-1,1,1-trifluoro-4-phenyl-3-phenylsulfanylbut-2-en-2-ol.
| Compound Name | (Z)-1,1,1-trifluoro-4-phenyl-3-phenylsulfanylbut-2-en-2-ol |
|---|---|
| PubChem CID | 135036230 |
| Molecular Formula | C16H13F3OS |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | (Z)-1,1,1-trifluoro-4-phenyl-3-phenylsulfanylbut-2-en-2-ol |
| SMILES | O/C(=C(/Cc1ccccc1)Sc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H13F3OS/c17-16(18,19)15(20)14(11-12-7-3-1-4-8-12)21-13-9-5-2-6-10-13/h1-10,20H,11H2/b15-14- |
| InChIKey | HMHBARFELCVRQW-PFONDFGASA-N |
| XLogP | 5.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|