C17H16OS — CID 13331795
[(1E,3E)-1-methoxy-4-phenylbuta-1,3-dienyl]sulfanylbenzene (PubChem CID 13331795) has the molecular formula C17H16OS and a molecular weight of 268.38 g/mol. Its IUPAC name is [(1E,3E)-1-methoxy-4-phenylbuta-1,3-dienyl]sulfanylbenzene.
| Compound Name | [(1E,3E)-1-methoxy-4-phenylbuta-1,3-dienyl]sulfanylbenzene |
|---|---|
| PubChem CID | 13331795 |
| Molecular Formula | C17H16OS |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | [(1E,3E)-1-methoxy-4-phenylbuta-1,3-dienyl]sulfanylbenzene |
| SMILES | CO/C(=C\C=C\c1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C17H16OS/c1-18-17(19-16-12-6-3-7-13-16)14-8-11-15-9-4-2-5-10-15/h2-14H,1H3/b11-8+,17-14+ |
| InChIKey | MXWGUPKOUBYDSL-LDRANXPESA-N |
| XLogP | 4.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|