C11H10BrF3OS — CID 10616154
[(Z)-1-bromo-2-ethoxy-3,3,3-trifluoroprop-1-enyl]sulfanylbenzene (PubChem CID 10616154) has the molecular formula C11H10BrF3OS and a molecular weight of 327.16 g/mol. Its IUPAC name is [(Z)-1-bromo-2-ethoxy-3,3,3-trifluoroprop-1-enyl]sulfanylbenzene.
| Compound Name | [(Z)-1-bromo-2-ethoxy-3,3,3-trifluoroprop-1-enyl]sulfanylbenzene |
|---|---|
| PubChem CID | 10616154 |
| Molecular Formula | C11H10BrF3OS |
| Molecular Weight | 327.16 g/mol |
| Exact Mass | 325.96 |
| IUPAC Name | [(Z)-1-bromo-2-ethoxy-3,3,3-trifluoroprop-1-enyl]sulfanylbenzene |
| SMILES | CCO/C(=C(\Br)Sc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H10BrF3OS/c1-2-16-9(11(13,14)15)10(12)17-8-6-4-3-5-7-8/h3-7H,2H2,1H3/b10-9+ |
| InChIKey | LDRBUCORIVGDTO-MDZDMXLPSA-N |
| XLogP | 4.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.16 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|