C14H6F16O2S — CID 134920795
[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]sulfanylbenzene (PubChem CID 134920795) has the molecular formula C14H6F16O2S and a molecular weight of 542.24 g/mol. Its IUPAC name is [1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]sulfanylbenzene.
| Compound Name | [1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]sulfanylbenzene |
|---|---|
| PubChem CID | 134920795 |
| Molecular Formula | C14H6F16O2S |
| Molecular Weight | 542.24 g/mol |
| Exact Mass | 541.98 |
| IUPAC Name | [1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]sulfanylbenzene |
| SMILES | FC(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)Sc1ccccc1 |
| InChI | InChI=1S/C14H6F16O2S/c15-7(8(16,17)33-6-4-2-1-3-5-6)31-14(29,30)10(20,12(24,25)26)32-13(27,28)9(18,19)11(21,22)23/h1-5,7H |
| InChIKey | WIBBHONOADDPRZ-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.24 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|