C10H8F2O3S — CID 11379595
4-[difluoro(phenylsulfanyl)methyl]-1,3-dioxolan-2-one (PubChem CID 11379595) has the molecular formula C10H8F2O3S and a molecular weight of 246.23 g/mol. Its IUPAC name is 4-[difluoro(phenylsulfanyl)methyl]-1,3-dioxolan-2-one.
| Compound Name | 4-[difluoro(phenylsulfanyl)methyl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 11379595 |
| Molecular Formula | C10H8F2O3S |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 4-[difluoro(phenylsulfanyl)methyl]-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(C(F)(F)Sc2ccccc2)O1 |
| InChI | InChI=1S/C10H8F2O3S/c11-10(12,8-6-14-9(13)15-8)16-7-4-2-1-3-5-7/h1-5,8H,6H2 |
| InChIKey | FLMRSWWIEBNPSB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |