C9H7FO3S — CID 11367875
4-fluoro-4-phenylsulfanyl-1,3-dioxolan-2-one (PubChem CID 11367875) has the molecular formula C9H7FO3S and a molecular weight of 214.22 g/mol. Its IUPAC name is 4-fluoro-4-phenylsulfanyl-1,3-dioxolan-2-one.
| Compound Name | 4-fluoro-4-phenylsulfanyl-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 11367875 |
| Molecular Formula | C9H7FO3S |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | 4-fluoro-4-phenylsulfanyl-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(F)(Sc2ccccc2)O1 |
| InChI | InChI=1S/C9H7FO3S/c10-9(6-12-8(11)13-9)14-7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | VBKGGWQQPLEBOG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |