C10H9FO3S — CID 11276240
4-[fluoro(phenylsulfanyl)methyl]-1,3-dioxolan-2-one (PubChem CID 11276240) has the molecular formula C10H9FO3S and a molecular weight of 228.24 g/mol. Its IUPAC name is 4-[fluoro(phenylsulfanyl)methyl]-1,3-dioxolan-2-one.
| Compound Name | 4-[fluoro(phenylsulfanyl)methyl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 11276240 |
| Molecular Formula | C10H9FO3S |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | 4-[fluoro(phenylsulfanyl)methyl]-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(C(F)Sc2ccccc2)O1 |
| InChI | InChI=1S/C10H9FO3S/c11-9(8-6-13-10(12)14-8)15-7-4-2-1-3-5-7/h1-5,8-9H,6H2 |
| InChIKey | QLKVDPLXDLPBIE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |