C10H6F6OS — CID 15514700
3-phenylsulfanyl-2,2-bis(trifluoromethyl)oxirane (PubChem CID 15514700) has the molecular formula C10H6F6OS and a molecular weight of 288.21 g/mol. Its IUPAC name is 3-phenylsulfanyl-2,2-bis(trifluoromethyl)oxirane.
| Compound Name | 3-phenylsulfanyl-2,2-bis(trifluoromethyl)oxirane |
|---|---|
| PubChem CID | 15514700 |
| Molecular Formula | C10H6F6OS |
| Molecular Weight | 288.21 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 3-phenylsulfanyl-2,2-bis(trifluoromethyl)oxirane |
| SMILES | FC(F)(F)C1(C(F)(F)F)OC1Sc1ccccc1 |
| InChI | InChI=1S/C10H6F6OS/c11-9(12,13)8(10(14,15)16)7(17-8)18-6-4-2-1-3-5-6/h1-5,7H |
| InChIKey | XRWMUUGMLFWACJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.21 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|