C14H10F12O2S3Se — CID 134881956
2-[(S)-[(1R)-1-(disulfanyl)-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]selanyl-phenylsulfanylmethyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 134881956) has the molecular formula C14H10F12O2S3Se and a molecular weight of 613.37 g/mol. Its IUPAC name is 2-[(S)-[(1R)-1-(disulfanyl)-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]selanyl-phenylsulfanylmethyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[(S)-[(1R)-1-(disulfanyl)-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]selanyl-phenylsulfanylmethyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 134881956 |
| Molecular Formula | C14H10F12O2S3Se |
| Molecular Weight | 613.37 g/mol |
| Exact Mass | 613.88 |
| IUPAC Name | 2-[(S)-[(1R)-1-(disulfanyl)-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]selanyl-phenylsulfanylmethyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC([C@H](SS)[Se][C@H](Sc1ccccc1)C(O)(C(F)(F)F)C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H10F12O2S3Se/c15-11(16,17)9(27,12(18,19)20)7(30-6-4-2-1-3-5-6)32-8(31-29)10(28,13(21,22)23)14(24,25)26/h1-5,7-8,27-29H/t7-,8+/m0/s1 |
| InChIKey | RMNZFBPNMQPLPK-JGVFFNPUSA-N |
| XLogP | 5.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.37 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|