C20H14F12O2S2Se — CID 15514696
1,1,1,3,3,3-hexafluoro-2-[(S)-phenylsulfanyl-[(1S)-3,3,3-trifluoro-2-hydroxy-1-phenylsulfanyl-2-(trifluoromethyl)propyl]selanylmethyl]propan-2-ol (PubChem CID 15514696) has the molecular formula C20H14F12O2S2Se and a molecular weight of 657.40 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[(S)-phenylsulfanyl-[(1S)-3,3,3-trifluoro-2-hydroxy-1-phenylsulfanyl-2-(trifluoromethyl)propyl]selanylmethyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[(S)-phenylsulfanyl-[(1S)-3,3,3-trifluoro-2-hydroxy-1-phenylsulfanyl-2-(trifluoromethyl)propyl]selanylmethyl]propan-2-ol |
|---|---|
| PubChem CID | 15514696 |
| Molecular Formula | C20H14F12O2S2Se |
| Molecular Weight | 657.40 g/mol |
| Exact Mass | 657.94 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[(S)-phenylsulfanyl-[(1S)-3,3,3-trifluoro-2-hydroxy-1-phenylsulfanyl-2-(trifluoromethyl)propyl]selanylmethyl]propan-2-ol |
| SMILES | OC([C@@H](Sc1ccccc1)[Se][C@H](Sc1ccccc1)C(O)(C(F)(F)F)C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H14F12O2S2Se/c21-17(22,23)15(33,18(24,25)26)13(35-11-7-3-1-4-8-11)37-14(36-12-9-5-2-6-10-12)16(34,19(27,28)29)20(30,31)32/h1-10,13-14,33-34H/t13-,14-/m0/s1 |
| InChIKey | URUSUAZZVXXEDR-KBPBESRZSA-N |
| XLogP | 6.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.40 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|