C20H12F12O2S2Se — CID 15514698
(3S,7S)-3,7-bis(phenylsulfanyl)-2,2,6,6-tetrakis(trifluoromethyl)-1,5-dioxa-4lambda4-selenaspiro[3.3]heptane (PubChem CID 15514698) has the molecular formula C20H12F12O2S2Se and a molecular weight of 655.38 g/mol. Its IUPAC name is (3S,7S)-3,7-bis(phenylsulfanyl)-2,2,6,6-tetrakis(trifluoromethyl)-1,5-dioxa-4lambda4-selenaspiro[3.3]heptane.
| Compound Name | (3S,7S)-3,7-bis(phenylsulfanyl)-2,2,6,6-tetrakis(trifluoromethyl)-1,5-dioxa-4lambda4-selenaspiro[3.3]heptane |
|---|---|
| PubChem CID | 15514698 |
| Molecular Formula | C20H12F12O2S2Se |
| Molecular Weight | 655.38 g/mol |
| Exact Mass | 655.93 |
| IUPAC Name | (3S,7S)-3,7-bis(phenylsulfanyl)-2,2,6,6-tetrakis(trifluoromethyl)-1,5-dioxa-4lambda4-selenaspiro[3.3]heptane |
| SMILES | FC(F)(F)C1(C(F)(F)F)O[Se]2(OC(C(F)(F)F)(C(F)(F)F)[C@H]2Sc2ccccc2)[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C20H12F12O2S2Se/c21-17(22,23)15(18(24,25)26)13(35-11-7-3-1-4-8-11)37(33-15)14(36-12-9-5-2-6-10-12)16(34-37,19(27,28)29)20(30,31)32/h1-10,13-14H/t13-,14-/m0/s1 |
| InChIKey | NGVQDHQBWWSGSU-KBPBESRZSA-N |
| XLogP | 7.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.38 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|