C14H8F12O2S3Se — CID 134926168
(3R,7S)-3-(disulfanyl)-7-phenylsulfanyl-2,2,6,6-tetrakis(trifluoromethyl)-1,5-dioxa-4λ4-selenaspiro[3.3]heptane (PubChem CID 134926168) has the molecular formula C14H8F12O2S3Se and a molecular weight of 611.35 g/mol. Its IUPAC name is (3R,7S)-3-(disulfanyl)-7-phenylsulfanyl-2,2,6,6-tetrakis(trifluoromethyl)-1,5-dioxa-4λ4-selenaspiro[3.3]heptane.
| Compound Name | (3R,7S)-3-(disulfanyl)-7-phenylsulfanyl-2,2,6,6-tetrakis(trifluoromethyl)-1,5-dioxa-4λ4-selenaspiro[3.3]heptane |
|---|---|
| PubChem CID | 134926168 |
| Molecular Formula | C14H8F12O2S3Se |
| Molecular Weight | 611.35 g/mol |
| Exact Mass | 611.87 |
| IUPAC Name | (3R,7S)-3-(disulfanyl)-7-phenylsulfanyl-2,2,6,6-tetrakis(trifluoromethyl)-1,5-dioxa-4λ4-selenaspiro[3.3]heptane |
| SMILES | FC(F)(F)C1(C(F)(F)F)O[Se]2(OC(C(F)(F)F)(C(F)(F)F)[C@@H]2SS)C1Sc1ccccc1 |
| InChI | InChI=1S/C14H8F12O2S3Se/c15-11(16,17)9(12(18,19)20)7(30-6-4-2-1-3-5-6)32(27-9)8(31-29)10(28-32,13(21,22)23)14(24,25)26/h1-5,7-8,29H/t7?,8-/m1/s1 |
| InChIKey | IALJGBIZQGYVOC-BRFYHDHCSA-N |
| XLogP | 6.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.35 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|