C17H18OS2 — CID 11162461
(Z)-2-methyl-3,4-bis(phenylsulfanyl)but-3-en-2-ol (PubChem CID 11162461) has the molecular formula C17H18OS2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (Z)-2-methyl-3,4-bis(phenylsulfanyl)but-3-en-2-ol.
| Compound Name | (Z)-2-methyl-3,4-bis(phenylsulfanyl)but-3-en-2-ol |
|---|---|
| PubChem CID | 11162461 |
| Molecular Formula | C17H18OS2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | (Z)-2-methyl-3,4-bis(phenylsulfanyl)but-3-en-2-ol |
| SMILES | CC(C)(O)/C(=C/Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C17H18OS2/c1-17(2,18)16(20-15-11-7-4-8-12-15)13-19-14-9-5-3-6-10-14/h3-13,18H,1-2H3/b16-13- |
| InChIKey | GPCDKGJGEAVPRC-SSZFMOIBSA-N |
| XLogP | 5.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |