C16H14F3OS2+ — CID 135013381
phenyl-(4,4,4-trifluoro-3-hydroxy-3-phenylsulfanylbutylidene)sulfanium (PubChem CID 135013381) has the molecular formula C16H14F3OS2+ and a molecular weight of 343.42 g/mol. Its IUPAC name is phenyl-(4,4,4-trifluoro-3-hydroxy-3-phenylsulfanylbutylidene)sulfanium.
| Compound Name | phenyl-(4,4,4-trifluoro-3-hydroxy-3-phenylsulfanylbutylidene)sulfanium |
|---|---|
| PubChem CID | 135013381 |
| Molecular Formula | C16H14F3OS2+ |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | phenyl-(4,4,4-trifluoro-3-hydroxy-3-phenylsulfanylbutylidene)sulfanium |
| SMILES | OC(C/C=[S+]/c1ccccc1)(Sc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H14F3OS2/c17-16(18,19)15(20,22-14-9-5-2-6-10-14)11-12-21-13-7-3-1-4-8-13/h1-10,12,20H,11H2/q+1 |
| InChIKey | JTAZFFPXMYAJCY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|