C14H12F3S+ — CID 20802361
diphenyl(2,2,2-trifluoroethyl)sulfanium (PubChem CID 20802361) has the molecular formula C14H12F3S+ and a molecular weight of 269.31 g/mol. Its IUPAC name is diphenyl(2,2,2-trifluoroethyl)sulfanium.
| Compound Name | diphenyl(2,2,2-trifluoroethyl)sulfanium |
|---|---|
| PubChem CID | 20802361 |
| Molecular Formula | C14H12F3S+ |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | diphenyl(2,2,2-trifluoroethyl)sulfanium |
| SMILES | FC(F)(F)C[S+](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12F3S/c15-14(16,17)11-18(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10H,11H2/q+1 |
| InChIKey | CXTJJHIBYIHCCO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|