About phenylsulfanylbenzene
phenylsulfanylbenzene (PubChem CID 8766) has the molecular formula C12H10S
and a molecular weight of 186.28 g/mol. Its IUPAC name is phenylsulfanylbenzene.
Molecular Properties
| Compound Name | phenylsulfanylbenzene |
| PubChem CID | 8766 |
| Molecular Formula | C12H10S |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | phenylsulfanylbenzene |
| SMILES | c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10H |
| InChIKey | LTYMSROWYAPPGB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze phenylsulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylsulfanylbenzene?
The IUPAC name of phenylsulfanylbenzene (CID 8766) is phenylsulfanylbenzene.
What is the SMILES notation for phenylsulfanylbenzene?
The canonical SMILES for phenylsulfanylbenzene is c1ccc(Sc2ccccc2)cc1.
What is the InChIKey of phenylsulfanylbenzene?
The InChIKey is LTYMSROWYAPPGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10H.
What are the key properties of phenylsulfanylbenzene?
phenylsulfanylbenzene has a molecular weight of 186.28 g/mol, XLogP of 3.84, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenylsulfanylbenzene is sourced from PubChem (CID 8766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).