C16H15F3O2S2 — CID 24874147
1,1,1-trifluoro-4,4-bis(phenylsulfanyl)butane-2,2-diol (PubChem CID 24874147) has the molecular formula C16H15F3O2S2 and a molecular weight of 360.42 g/mol. Its IUPAC name is 1,1,1-trifluoro-4,4-bis(phenylsulfanyl)butane-2,2-diol.
| Compound Name | 1,1,1-trifluoro-4,4-bis(phenylsulfanyl)butane-2,2-diol |
|---|---|
| PubChem CID | 24874147 |
| Molecular Formula | C16H15F3O2S2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 1,1,1-trifluoro-4,4-bis(phenylsulfanyl)butane-2,2-diol |
| SMILES | OC(O)(CC(Sc1ccccc1)Sc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H15F3O2S2/c17-16(18,19)15(20,21)11-14(22-12-7-3-1-4-8-12)23-13-9-5-2-6-10-13/h1-10,14,20-21H,11H2 |
| InChIKey | SSJWYLGTGGLKDF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|