C10H12F2O3S — CID 11448070
1-(benzenesulfonyl)-1,1-difluoro-2-methylpropan-2-ol (PubChem CID 11448070) has the molecular formula C10H12F2O3S and a molecular weight of 250.27 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-1,1-difluoro-2-methylpropan-2-ol.
| Compound Name | 1-(benzenesulfonyl)-1,1-difluoro-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 11448070 |
| Molecular Formula | C10H12F2O3S |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 1-(benzenesulfonyl)-1,1-difluoro-2-methylpropan-2-ol |
| SMILES | CC(C)(O)C(F)(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C10H12F2O3S/c1-9(2,13)10(11,12)16(14,15)8-6-4-3-5-7-8/h3-7,13H,1-2H3 |
| InChIKey | MWJRCNUUIPOQFK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |