About [(E)-1,2-difluoroethenyl]sulfonylbenzene
[(E)-1,2-difluoroethenyl]sulfonylbenzene (PubChem CID 15318623) has the molecular formula C8H6F2O2S
and a molecular weight of 204.20 g/mol. Its IUPAC name is [(E)-1,2-difluoroethenyl]sulfonylbenzene.
Molecular Properties
| Compound Name | [(E)-1,2-difluoroethenyl]sulfonylbenzene |
| PubChem CID | 15318623 |
| Molecular Formula | C8H6F2O2S |
| Molecular Weight | 204.20 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | [(E)-1,2-difluoroethenyl]sulfonylbenzene |
| SMILES | O=S(=O)(/C(F)=C/F)c1ccccc1 |
| InChI | InChI=1S/C8H6F2O2S/c9-6-8(10)13(11,12)7-4-2-1-3-5-7/h1-6H/b8-6+ |
| InChIKey | DAFGCJZYKUPTGZ-SOFGYWHQSA-N |
| XLogP | 2.20 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.20 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(E)-1,2-difluoroethenyl]sulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1,2-difluoroethenyl]sulfonylbenzene?
The IUPAC name of [(E)-1,2-difluoroethenyl]sulfonylbenzene (CID 15318623) is [(E)-1,2-difluoroethenyl]sulfonylbenzene.
What is the SMILES notation for [(E)-1,2-difluoroethenyl]sulfonylbenzene?
The canonical SMILES for [(E)-1,2-difluoroethenyl]sulfonylbenzene is O=S(=O)(/C(F)=C/F)c1ccccc1.
What is the InChIKey of [(E)-1,2-difluoroethenyl]sulfonylbenzene?
The InChIKey is DAFGCJZYKUPTGZ-SOFGYWHQSA-N. The full InChI is InChI=1S/C8H6F2O2S/c9-6-8(10)13(11,12)7-4-2-1-3-5-7/h1-6H/b8-6+.
What are the key properties of [(E)-1,2-difluoroethenyl]sulfonylbenzene?
[(E)-1,2-difluoroethenyl]sulfonylbenzene has a molecular weight of 204.20 g/mol, XLogP of 2.20, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1,2-difluoroethenyl]sulfonylbenzene is sourced from PubChem (CID 15318623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).