About methylsulfinylbenzene
methylsulfinylbenzene (PubChem CID 14516) has the molecular formula C7H8OS
and a molecular weight of 140.21 g/mol. Its IUPAC name is methylsulfinylbenzene.
Molecular Properties
| Compound Name | methylsulfinylbenzene |
| PubChem CID | 14516 |
| Molecular Formula | C7H8OS |
| Molecular Weight | 140.21 g/mol |
| Exact Mass | 140.03 |
| IUPAC Name | methylsulfinylbenzene |
| SMILES | CS(=O)c1ccccc1 |
| InChI | InChI=1S/C7H8OS/c1-9(8)7-5-3-2-4-6-7/h2-6H,1H3 |
| InChIKey | JXTGICXCHWMCPM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.21 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methylsulfinylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylsulfinylbenzene?
The IUPAC name of methylsulfinylbenzene (CID 14516) is methylsulfinylbenzene.
What is the SMILES notation for methylsulfinylbenzene?
The canonical SMILES for methylsulfinylbenzene is CS(=O)c1ccccc1.
What is the InChIKey of methylsulfinylbenzene?
The InChIKey is JXTGICXCHWMCPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8OS/c1-9(8)7-5-3-2-4-6-7/h2-6H,1H3.
What are the key properties of methylsulfinylbenzene?
methylsulfinylbenzene has a molecular weight of 140.21 g/mol, XLogP of 1.42, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methylsulfinylbenzene is sourced from PubChem (CID 14516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).