C14H15F3OS — CID 10661002
[(2E)-2-ethoxy-1,1,1-trifluorohexa-2,5-dien-3-yl]sulfanylbenzene (PubChem CID 10661002) has the molecular formula C14H15F3OS and a molecular weight of 288.33 g/mol. Its IUPAC name is [(2E)-2-ethoxy-1,1,1-trifluorohexa-2,5-dien-3-yl]sulfanylbenzene.
| Compound Name | [(2E)-2-ethoxy-1,1,1-trifluorohexa-2,5-dien-3-yl]sulfanylbenzene |
|---|---|
| PubChem CID | 10661002 |
| Molecular Formula | C14H15F3OS |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | [(2E)-2-ethoxy-1,1,1-trifluorohexa-2,5-dien-3-yl]sulfanylbenzene |
| SMILES | C=CC/C(Sc1ccccc1)=C(\OCC)C(F)(F)F |
| InChI | InChI=1S/C14H15F3OS/c1-3-8-12(13(18-4-2)14(15,16)17)19-11-9-6-5-7-10-11/h3,5-7,9-10H,1,4,8H2,2H3/b13-12+ |
| InChIKey | INCSXVXTQLHXNG-OUKQBFOZSA-N |
| XLogP | 5.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|