C21H17F5O2S — CID 15366634
(Z)-5-ethoxy-6,6,7,7,7-pentafluoro-1-phenyl-4-phenylsulfanylhept-4-en-1-yn-3-ol (PubChem CID 15366634) has the molecular formula C21H17F5O2S and a molecular weight of 428.42 g/mol. Its IUPAC name is (Z)-5-ethoxy-6,6,7,7,7-pentafluoro-1-phenyl-4-phenylsulfanylhept-4-en-1-yn-3-ol.
| Compound Name | (Z)-5-ethoxy-6,6,7,7,7-pentafluoro-1-phenyl-4-phenylsulfanylhept-4-en-1-yn-3-ol |
|---|---|
| PubChem CID | 15366634 |
| Molecular Formula | C21H17F5O2S |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | (Z)-5-ethoxy-6,6,7,7,7-pentafluoro-1-phenyl-4-phenylsulfanylhept-4-en-1-yn-3-ol |
| SMILES | CCO/C(=C(\Sc1ccccc1)C(O)C#Cc1ccccc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H17F5O2S/c1-2-28-19(20(22,23)21(24,25)26)18(29-16-11-7-4-8-12-16)17(27)14-13-15-9-5-3-6-10-15/h3-12,17,27H,2H2,1H3/b19-18- |
| InChIKey | QCOVLUBGKXOUBG-HNENSFHCSA-N |
| XLogP | 5.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|