C16H17F5O2S — CID 10523037
(1E,4E)-5-ethoxy-6,6,7,7,7-pentafluoro-4-methylsulfanyl-1-phenylhepta-1,4-dien-3-ol (PubChem CID 10523037) has the molecular formula C16H17F5O2S and a molecular weight of 368.37 g/mol. Its IUPAC name is (1E,4E)-5-ethoxy-6,6,7,7,7-pentafluoro-4-methylsulfanyl-1-phenylhepta-1,4-dien-3-ol.
| Compound Name | (1E,4E)-5-ethoxy-6,6,7,7,7-pentafluoro-4-methylsulfanyl-1-phenylhepta-1,4-dien-3-ol |
|---|---|
| PubChem CID | 10523037 |
| Molecular Formula | C16H17F5O2S |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | (1E,4E)-5-ethoxy-6,6,7,7,7-pentafluoro-4-methylsulfanyl-1-phenylhepta-1,4-dien-3-ol |
| SMILES | CCO/C(=C(/SC)C(O)/C=C/c1ccccc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H17F5O2S/c1-3-23-14(15(17,18)16(19,20)21)13(24-2)12(22)10-9-11-7-5-4-6-8-11/h4-10,12,22H,3H2,1-2H3/b10-9+,14-13+ |
| InChIKey | RUBUUYYSHHKONK-LBSPPQMYSA-N |
| XLogP | 4.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|