C13H15F3O2S — CID 10565557
(E)-3-ethoxy-4,4,4-trifluoro-2-methylsulfanyl-1-phenylbut-2-en-1-ol (PubChem CID 10565557) has the molecular formula C13H15F3O2S and a molecular weight of 292.32 g/mol. Its IUPAC name is (E)-3-ethoxy-4,4,4-trifluoro-2-methylsulfanyl-1-phenylbut-2-en-1-ol.
| Compound Name | (E)-3-ethoxy-4,4,4-trifluoro-2-methylsulfanyl-1-phenylbut-2-en-1-ol |
|---|---|
| PubChem CID | 10565557 |
| Molecular Formula | C13H15F3O2S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | (E)-3-ethoxy-4,4,4-trifluoro-2-methylsulfanyl-1-phenylbut-2-en-1-ol |
| SMILES | CCO/C(=C(/SC)C(O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H15F3O2S/c1-3-18-12(13(14,15)16)11(19-2)10(17)9-7-5-4-6-8-9/h4-8,10,17H,3H2,1-2H3/b12-11+ |
| InChIKey | MIPUFUSUXXPFQS-VAWYXSNFSA-N |
| XLogP | 3.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|