C14H15F5O2S — CID 10831148
(E)-3-ethoxy-4,4,5,5,5-pentafluoro-2-methylsulfanyl-1-phenylpent-2-en-1-ol (PubChem CID 10831148) has the molecular formula C14H15F5O2S and a molecular weight of 342.33 g/mol. Its IUPAC name is (E)-3-ethoxy-4,4,5,5,5-pentafluoro-2-methylsulfanyl-1-phenylpent-2-en-1-ol.
| Compound Name | (E)-3-ethoxy-4,4,5,5,5-pentafluoro-2-methylsulfanyl-1-phenylpent-2-en-1-ol |
|---|---|
| PubChem CID | 10831148 |
| Molecular Formula | C14H15F5O2S |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | (E)-3-ethoxy-4,4,5,5,5-pentafluoro-2-methylsulfanyl-1-phenylpent-2-en-1-ol |
| SMILES | CCO/C(=C(/SC)C(O)c1ccccc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H15F5O2S/c1-3-21-12(13(15,16)14(17,18)19)11(22-2)10(20)9-7-5-4-6-8-9/h4-8,10,20H,3H2,1-2H3/b12-11+ |
| InChIKey | SRAWKDUPOICMHG-VAWYXSNFSA-N |
| XLogP | 4.53 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|