C14H13F3O2 — CID 10492249
(Z)-5-ethoxy-6,6,6-trifluoro-1-phenylhex-4-en-1-yn-3-ol (PubChem CID 10492249) has the molecular formula C14H13F3O2 and a molecular weight of 270.25 g/mol. Its IUPAC name is (Z)-5-ethoxy-6,6,6-trifluoro-1-phenylhex-4-en-1-yn-3-ol.
| Compound Name | (Z)-5-ethoxy-6,6,6-trifluoro-1-phenylhex-4-en-1-yn-3-ol |
|---|---|
| PubChem CID | 10492249 |
| Molecular Formula | C14H13F3O2 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (Z)-5-ethoxy-6,6,6-trifluoro-1-phenylhex-4-en-1-yn-3-ol |
| SMILES | CCO/C(=C\C(O)C#Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C14H13F3O2/c1-2-19-13(14(15,16)17)10-12(18)9-8-11-6-4-3-5-7-11/h3-7,10,12,18H,2H2,1H3/b13-10- |
| InChIKey | ZTUAXZIYEFRRBL-RAXLEYEMSA-N |
| XLogP | 2.88 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|