C17H12F2O — CID 102383487
(E)-5-(2,4-difluorophenyl)-1-phenylpent-1-en-4-yn-3-ol (PubChem CID 102383487) has the molecular formula C17H12F2O and a molecular weight of 270.28 g/mol. Its IUPAC name is (E)-5-(2,4-difluorophenyl)-1-phenylpent-1-en-4-yn-3-ol.
| Compound Name | (E)-5-(2,4-difluorophenyl)-1-phenylpent-1-en-4-yn-3-ol |
|---|---|
| PubChem CID | 102383487 |
| Molecular Formula | C17H12F2O |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (E)-5-(2,4-difluorophenyl)-1-phenylpent-1-en-4-yn-3-ol |
| SMILES | OC(C#Cc1ccc(F)cc1F)/C=C/c1ccccc1 |
| InChI | InChI=1S/C17H12F2O/c18-15-9-7-14(17(19)12-15)8-11-16(20)10-6-13-4-2-1-3-5-13/h1-7,9-10,12,16,20H/b10-6+ |
| InChIKey | XTCYAAUQIIJWMA-UXBLZVDNSA-N |
| XLogP | 3.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|