C14H18F2O2 — CID 11097185
(Z)-5-ethoxy-4,4-difluoro-6-phenylhex-5-en-3-ol (PubChem CID 11097185) has the molecular formula C14H18F2O2 and a molecular weight of 256.29 g/mol. Its IUPAC name is (Z)-5-ethoxy-4,4-difluoro-6-phenylhex-5-en-3-ol.
| Compound Name | (Z)-5-ethoxy-4,4-difluoro-6-phenylhex-5-en-3-ol |
|---|---|
| PubChem CID | 11097185 |
| Molecular Formula | C14H18F2O2 |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (Z)-5-ethoxy-4,4-difluoro-6-phenylhex-5-en-3-ol |
| SMILES | CCO/C(=C\c1ccccc1)C(F)(F)C(O)CC |
| InChI | InChI=1S/C14H18F2O2/c1-3-12(17)14(15,16)13(18-4-2)10-11-8-6-5-7-9-11/h5-10,12,17H,3-4H2,1-2H3/b13-10- |
| InChIKey | YBIKXCXEXAPONF-RAXLEYEMSA-N |
| XLogP | 3.47 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|