C19H23F3O — CID 11131146
[(1E,3E,4E)-3-(1-ethoxy-2,2,2-trifluoroethylidene)nona-1,4-dienyl]benzene (PubChem CID 11131146) has the molecular formula C19H23F3O and a molecular weight of 324.39 g/mol. Its IUPAC name is [(1E,3E,4E)-3-(1-ethoxy-2,2,2-trifluoroethylidene)nona-1,4-dienyl]benzene.
| Compound Name | [(1E,3E,4E)-3-(1-ethoxy-2,2,2-trifluoroethylidene)nona-1,4-dienyl]benzene |
|---|---|
| PubChem CID | 11131146 |
| Molecular Formula | C19H23F3O |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | [(1E,3E,4E)-3-(1-ethoxy-2,2,2-trifluoroethylidene)nona-1,4-dienyl]benzene |
| SMILES | CCCC/C=C/C(/C=C/c1ccccc1)=C(\OCC)C(F)(F)F |
| InChI | InChI=1S/C19H23F3O/c1-3-5-6-10-13-17(18(23-4-2)19(20,21)22)15-14-16-11-8-7-9-12-16/h7-15H,3-6H2,1-2H3/b13-10+,15-14+,18-17+ |
| InChIKey | KDIOEYNOFWOJOL-JOJIBTQTSA-N |
| XLogP | 6.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|