C25H34F2OS — CID 142267506
[(2E,4E)-6,6-difluoro-2-methyl-1-[(3E,5Z)-7-methylnona-3,5-dien-4-yl]oxy-5-methylsulfanylhepta-2,4-dien-4-yl]benzene (PubChem CID 142267506) has the molecular formula C25H34F2OS and a molecular weight of 420.61 g/mol. Its IUPAC name is [(2E,4E)-6,6-difluoro-2-methyl-1-[(3E,5Z)-7-methylnona-3,5-dien-4-yl]oxy-5-methylsulfanylhepta-2,4-dien-4-yl]benzene.
| Compound Name | [(2E,4E)-6,6-difluoro-2-methyl-1-[(3E,5Z)-7-methylnona-3,5-dien-4-yl]oxy-5-methylsulfanylhepta-2,4-dien-4-yl]benzene |
|---|---|
| PubChem CID | 142267506 |
| Molecular Formula | C25H34F2OS |
| Molecular Weight | 420.61 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | [(2E,4E)-6,6-difluoro-2-methyl-1-[(3E,5Z)-7-methylnona-3,5-dien-4-yl]oxy-5-methylsulfanylhepta-2,4-dien-4-yl]benzene |
| SMILES | CC/C=C(\C=C/C(C)CC)OC/C(C)=C/C(=C(\SC)C(C)(F)F)c1ccccc1 |
| InChI | InChI=1S/C25H34F2OS/c1-7-12-22(16-15-19(3)8-2)28-18-20(4)17-23(21-13-10-9-11-14-21)24(29-6)25(5,26)27/h9-17,19H,7-8,18H2,1-6H3/b16-15-,20-17+,22-12+,24-23+ |
| InChIKey | LKRWDARPCVRTND-QFKCDNNISA-N |
| XLogP | 8.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.61 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|