C18H16F5O- — CID 140804211
(5E)-2-(2,2,3,3,3-pentafluoropropoxy)-5-(1-phenylpropylidene)cyclohexa-1,3-diene (PubChem CID 140804211) has the molecular formula C18H16F5O- and a molecular weight of 343.32 g/mol. Its IUPAC name is (5E)-2-(2,2,3,3,3-pentafluoropropoxy)-5-(1-phenylpropylidene)cyclohexa-1,3-diene.
| Compound Name | (5E)-2-(2,2,3,3,3-pentafluoropropoxy)-5-(1-phenylpropylidene)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 140804211 |
| Molecular Formula | C18H16F5O- |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | (5E)-2-(2,2,3,3,3-pentafluoropropoxy)-5-(1-phenylpropylidene)cyclohexa-1,3-diene |
| SMILES | CC/C(=C1\C=CC(OCC(F)(F)C(F)(F)F)=C[CH-]1)c1ccccc1 |
| InChI | InChI=1S/C18H16F5O/c1-2-16(13-6-4-3-5-7-13)14-8-10-15(11-9-14)24-12-17(19,20)18(21,22)23/h3-11H,2,12H2,1H3/q-1 |
| InChIKey | GBADDVMSWJUJTQ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|