C15H17F3O — CID 134879406
[(E)-4-[(E)-but-2-enoxy]-5,5,5-trifluoropent-3-enyl]benzene (PubChem CID 134879406) has the molecular formula C15H17F3O and a molecular weight of 270.29 g/mol. Its IUPAC name is [(E)-4-[(E)-but-2-enoxy]-5,5,5-trifluoropent-3-enyl]benzene.
| Compound Name | [(E)-4-[(E)-but-2-enoxy]-5,5,5-trifluoropent-3-enyl]benzene |
|---|---|
| PubChem CID | 134879406 |
| Molecular Formula | C15H17F3O |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | [(E)-4-[(E)-but-2-enoxy]-5,5,5-trifluoropent-3-enyl]benzene |
| SMILES | C/C=C/CO/C(=C/CCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C15H17F3O/c1-2-3-12-19-14(15(16,17)18)11-7-10-13-8-5-4-6-9-13/h2-6,8-9,11H,7,10,12H2,1H3/b3-2+,14-11+ |
| InChIKey | JTONOBSLKADTEI-GJFJKGJZSA-N |
| XLogP | 4.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|