C15H19F3O2S — CID 100949766
[(Z)-3,3-diethoxy-4,4,4-trifluoro-2-methylsulfanylbut-1-enyl]benzene (PubChem CID 100949766) has the molecular formula C15H19F3O2S and a molecular weight of 320.38 g/mol. Its IUPAC name is [(Z)-3,3-diethoxy-4,4,4-trifluoro-2-methylsulfanylbut-1-enyl]benzene.
| Compound Name | [(Z)-3,3-diethoxy-4,4,4-trifluoro-2-methylsulfanylbut-1-enyl]benzene |
|---|---|
| PubChem CID | 100949766 |
| Molecular Formula | C15H19F3O2S |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | [(Z)-3,3-diethoxy-4,4,4-trifluoro-2-methylsulfanylbut-1-enyl]benzene |
| SMILES | CCOC(OCC)(/C(=C/c1ccccc1)SC)C(F)(F)F |
| InChI | InChI=1S/C15H19F3O2S/c1-4-19-14(20-5-2,15(16,17)18)13(21-3)11-12-9-7-6-8-10-12/h6-11H,4-5H2,1-3H3/b13-11- |
| InChIKey | YOAUIKBEHVTMNX-QBFSEMIESA-N |
| XLogP | 4.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|