C18H19F3O2S — CID 20693043
5-methylsulfanyl-2-[(1E,3E,5E)-6-[4-(trifluoromethyl)phenyl]hexa-1,3,5-trienyl]-1,3-dioxane (PubChem CID 20693043) has the molecular formula C18H19F3O2S and a molecular weight of 356.41 g/mol. Its IUPAC name is 5-methylsulfanyl-2-[(1E,3E,5E)-6-[4-(trifluoromethyl)phenyl]hexa-1,3,5-trienyl]-1,3-dioxane.
| Compound Name | 5-methylsulfanyl-2-[(1E,3E,5E)-6-[4-(trifluoromethyl)phenyl]hexa-1,3,5-trienyl]-1,3-dioxane |
|---|---|
| PubChem CID | 20693043 |
| Molecular Formula | C18H19F3O2S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 5-methylsulfanyl-2-[(1E,3E,5E)-6-[4-(trifluoromethyl)phenyl]hexa-1,3,5-trienyl]-1,3-dioxane |
| SMILES | CSC1COC(/C=C/C=C/C=C/c2ccc(C(F)(F)F)cc2)OC1 |
| InChI | InChI=1S/C18H19F3O2S/c1-24-16-12-22-17(23-13-16)7-5-3-2-4-6-14-8-10-15(11-9-14)18(19,20)21/h2-11,16-17H,12-13H2,1H3/b3-2+,6-4+,7-5+ |
| InChIKey | LGWFCLJIAOGSNW-NYYLHBDNSA-N |
| XLogP | 4.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|