C16H15F3O2S — CID 20693029
5-methylsulfanyl-2-[(E)-4-[4-(trifluoromethyl)phenyl]but-3-en-1-ynyl]-1,3-dioxane (PubChem CID 20693029) has the molecular formula C16H15F3O2S and a molecular weight of 328.36 g/mol. Its IUPAC name is 5-methylsulfanyl-2-[(E)-4-[4-(trifluoromethyl)phenyl]but-3-en-1-ynyl]-1,3-dioxane.
| Compound Name | 5-methylsulfanyl-2-[(E)-4-[4-(trifluoromethyl)phenyl]but-3-en-1-ynyl]-1,3-dioxane |
|---|---|
| PubChem CID | 20693029 |
| Molecular Formula | C16H15F3O2S |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 5-methylsulfanyl-2-[(E)-4-[4-(trifluoromethyl)phenyl]but-3-en-1-ynyl]-1,3-dioxane |
| SMILES | CSC1COC(C#C/C=C/c2ccc(C(F)(F)F)cc2)OC1 |
| InChI | InChI=1S/C16H15F3O2S/c1-22-14-10-20-15(21-11-14)5-3-2-4-12-6-8-13(9-7-12)16(17,18)19/h2,4,6-9,14-15H,10-11H2,1H3/b4-2+ |
| InChIKey | RGOOCAHCNQUTMZ-DUXPYHPUSA-N |
| XLogP | 3.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|